| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:34 UTC |
|---|
| Update Date | 2025-03-25 00:52:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195632 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O5 |
|---|
| Molecular Mass | 300.0998 |
|---|
| SMILES | CC1c2cc3c(cc2OC(c2cccc(O)c2)C1O)OCO3 |
|---|
| InChI Key | RSMMJBNRLWGFMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoidsacetalsalkyl aryl ethersbenzene and substituted derivativesbenzodioxolesflavan-3-olshydrocarbon derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheracetalaromatic heteropolycyclic compoundchromaneflavan-3-olorganoheterocyclic compoundbenzodioxolealcoholbenzopyran1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|