| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:35 UTC |
|---|
| Update Date | 2025-03-25 00:52:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195669 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O7S |
|---|
| Molecular Mass | 288.0304 |
|---|
| SMILES | CC1OC(=O)OC1Cc1cccc(OS(=O)(=O)O)c1 |
|---|
| InChI Key | ZWXCKCKULVTANI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanescarbonic acid diesterscarbonyl compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietymeta-dioxolanesulfuric acid monoestercarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundcarbonic acid diesterphenylsulfateoxacycleorganic oxideorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
