| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:39 UTC |
|---|
| Update Date | 2025-03-25 00:52:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195810 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H38O9 |
|---|
| Molecular Mass | 482.2516 |
|---|
| SMILES | CC12CC(O)C3C(CCC4OC(C(=O)O)C(O)C(O)C(O)C5CC(CCC43C)O5)C1CCC2=O |
|---|
| InChI Key | MLQYLLJKWJEVNF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | carboxylic acidscyclic alcohols and derivativesdialkyl ethershydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxetanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidcyclic alcoholcarboxylic acid derivativedialkyl etherketonealiphatic heteropolycyclic compoundoxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundoxetanesecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|