| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:42 UTC |
|---|
| Update Date | 2025-03-25 00:52:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02195957 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19NO7S |
|---|
| Molecular Mass | 297.0882 |
|---|
| SMILES | CC1(C)OC2CC(O)C(O)CC2(COS(N)(=O)=O)O1 |
|---|
| InChI Key | CTGWFVHYSIVREW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | ketals |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dioxolanescyclic alcohols and derivativeshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholmeta-dioxolaneorganic sulfuric acid or derivativescyclic alcoholaliphatic heteropolycyclic compoundoxacycleorganic oxideketalsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compound1,2-diol |
|---|