| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:44 UTC |
|---|
| Update Date | 2025-03-25 00:52:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02196025 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O8P |
|---|
| Molecular Mass | 256.0348 |
|---|
| SMILES | CC1(O)C(O)C(CO)OC2OP(=O)(O)OC21 |
|---|
| InChI Key | HWJLYHHNGCZSMF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | dioxaphospholaneshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholmonosaccharide1,3_dioxaphospholanealiphatic heteropolycyclic compoundoxacycletertiary alcoholorganic oxidesecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|