| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:46 UTC |
|---|
| Update Date | 2025-03-25 00:52:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02196087 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O7S |
|---|
| Molecular Mass | 223.9991 |
|---|
| SMILES | CC1=CC(OS(=O)(=O)O)C(O)C(=O)O1 |
|---|
| InChI Key | SFKDDKZFAYGZDK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundsenol estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesdihydropyranonecarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterenol esterorganooxygen compound |
|---|
