| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:52 UTC |
|---|
| Update Date | 2025-03-25 00:52:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02196321 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O4S |
|---|
| Molecular Mass | 216.0456 |
|---|
| SMILES | CC1=C(O)C(C)(CCC(=O)O)SC1=O |
|---|
| InChI Key | KJVDJGZNGAWURO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | thia fatty acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbothioic s-lactonescarboxylic acidsdihydrothiophenesfatty acylshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesorganic oxidesthioestersthiolactonesvinylogous acids |
|---|
| Substituents | carbothioic s-lactonethiocarboxylic acid or derivativescarbonyl groupcarboxylic acidthiocarboxylic acid ester2,5-dihydrothiophenecarboxylic acid derivativevinylogous acidorganic oxidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundaliphatic heteromonocyclic compoundhydrocarbon derivativehydroxy fatty acidthiolactoneorganoheterocyclic compoundorganooxygen compound |
|---|