| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:57:59 UTC |
|---|
| Update Date | 2025-03-25 00:52:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02196579 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O4 |
|---|
| Molecular Mass | 264.1362 |
|---|
| SMILES | CCC(CCC(C)=O)COc1ccc(C(=O)O)cc1 |
|---|
| InChI Key | MNLJQOMBZPTEJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbenzoyl derivativescarboxylic acidshydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidesphenol ethersphenoxy compounds |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidbenzoylalkyl aryl ethercarboxylic acid derivativeketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzoic acidphenoxy compoundorganooxygen compound |
|---|
