| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:02 UTC |
|---|
| Update Date | 2025-03-25 00:52:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02196678 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H20NO4+ |
|---|
| Molecular Mass | 218.1387 |
|---|
| SMILES | CCC(CC(=O)O)OC(=O)C[N+](C)(C)C |
|---|
| InChI Key | ZNPSGYNXKCNBHT-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | depsipeptides |
|---|
| Direct Parent | depsipeptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid estersalpha amino acidsaminescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmethyl-branched fatty acidsorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compounddepsipeptidecarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic cationorganic saltmethyl-branched fatty acidtetraalkylammonium saltalpha-amino acid esterquaternary ammonium saltbranched fatty acidorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
