| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:11 UTC |
|---|
| Update Date | 2025-03-25 00:52:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02197015 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H51N3O7 |
|---|
| Molecular Mass | 613.3727 |
|---|
| SMILES | CCC1C(C)C(Cc2[nH]c(Cc3[nH]c(CC4CCCN4C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)OC(C(=O)O)C1C |
|---|
| InChI Key | FNTUHTNUIRLMRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyrrolestrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidtricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundoxanepyrrolidinetertiary amineorganoheterocyclic compoundc-glucuronidepyran carboxylic acid or derivativesazacyclen-alkylpyrrolidineheteroaromatic compoundtertiary aliphatic amineoxacyclepyranpyrrolehydrocarbon derivativeorganic nitrogen compoundamine |
|---|