| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:18 UTC |
|---|
| Update Date | 2025-03-25 00:53:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02197313 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H19NO18P4 |
|---|
| Molecular Mass | 540.9553 |
|---|
| SMILES | CCC(=O)NC1OC(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | VAFQAGLSJKDUOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxamide groupcarboxylic acid derivativeoxacyclesecondary carboxylic acid amidesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
