| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:34 UTC |
|---|
| Update Date | 2025-03-25 00:53:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02197918 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O2 |
|---|
| Molecular Mass | 206.1055 |
|---|
| SMILES | Cc1ccc(C2CC(O)CC(=O)N2)cn1 |
|---|
| InChI Key | RFSIMOZZENIUEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonespolyhalopyridinessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundpolyhalopyridinecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinone2-halopyridinepiperidineorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundhydroxypyridinecarboxamide groupdelta-lactamsecondary carboxylic acid amidealkaloid or derivativespyridineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
