| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:36 UTC |
|---|
| Update Date | 2025-03-25 00:53:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02197988 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H41NO5 |
|---|
| Molecular Mass | 459.2985 |
|---|
| SMILES | O=C(O)CC=C(O)CCCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCO |
|---|
| InChI Key | ZRGMXKDKYZLYDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminesamino fatty acidscarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesn-acyl aminesn-acylethanolaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl grouplong-chain fatty acidcarboxylic acidfatty amidecarboxamide groupn-acylethanolaminecarboxylic acid derivativeamino fatty acidn-acyl-aminesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativehydroxy fatty acidorganic nitrogen compoundorganooxygen compoundalkanolamine |
|---|