DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 14:58:40 UTC
Update Date	2025-03-25 00:53:08 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02198147
Frequency	0.5
Structure
Chemical Formula	C₁₄H₂₂N₄O₆S
Molecular Mass	374.126
SMILES	COC1C(O)C(CSCCC(N)C(=O)O)OC1n1ccc(N)nc1=O
InChI Key	MUKLGVODYXEICA-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	nucleosides, nucleotides, and analogues
Class	5'-deoxyribonucleosides
Subclass	5'-deoxy-5'-thionucleosides
Direct Parent	5'-s-alkylthio-5'-deoxyribonucleosides
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	alpha amino acids amino acids azacyclic compounds carbonyl compounds carboxylic acids dialkyl ethers dialkylthioethers fatty acyls heteroaromatic compounds hydrocarbon derivatives hydroxy fatty acids imidolactams monoalkylamines monocarboxylic acids and derivatives monosaccharides organic carbonic acids and derivatives organic oxides organopnictogen compounds oxacyclic compounds pyrimidones secondary alcohols sulfenyl compounds tetrahydrofurans thia fatty acids
Substituents	fatty acyl carbonyl group ether carboxylic acid aromatic heteromonocyclic compound amino acid or derivatives amino acid monosaccharide pyrimidone alpha-amino acid or derivatives organosulfur compound carboxylic acid derivative dialkyl ether pyrimidine saccharide organic oxide 5'-s-alkylthio-5'-deoxyribonucleoside organonitrogen compound alpha-amino acid organopnictogen compound hydroxy fatty acid imidolactam organoheterocyclic compound alcohol carbonic acid derivative sulfenyl compound azacycle tetrahydrofuran dialkylthioether heteroaromatic compound oxacycle monocarboxylic acid or derivatives thia fatty acid organic oxygen compound thioether secondary alcohol hydrocarbon derivative primary aliphatic amine primary amine organic nitrogen compound amine organooxygen compound

Showing information for DMID02198147