| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:41 UTC |
|---|
| Update Date | 2025-03-25 00:53:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198217 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19INO+ |
|---|
| Molecular Mass | 320.0506 |
|---|
| SMILES | CC(Cc1cc(I)ccc1O)[N+](C)(C)C |
|---|
| InChI Key | GWWWWAHJXOTAKT-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminesaryl iodideshalophenolshydrocarbon derivativesiodobenzenesorganic cationsorganic saltsorganoiodidesorganooxygen compoundsorganopnictogen compoundsp-iodophenolsphenylpropanestetraalkylammonium salts |
|---|
| Substituents | 1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundiodobenzene4-iodophenolorganoiodidephenylpropane4-halophenolorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltamphetamine or derivativestetraalkylammonium saltquaternary ammonium saltaryl halidearomatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|