| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:44 UTC |
|---|
| Update Date | 2025-03-25 00:53:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198303 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17NOS |
|---|
| Molecular Mass | 271.1031 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)CSc1ccccc1 |
|---|
| InChI Key | KRGHFWCCULGJLP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkylarylthioetherscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compoundsthiophenol ethersthiophenolsm-xylenes |
|---|
| Substituents | carbonyl groupn-arylamidealkylarylthioetherorganosulfur compoundcarboxylic acid derivativearyl thioetherxyleneorganic oxidethiophenolthiophenol etherorganonitrogen compoundorganopnictogen compoundsulfenyl compoundm-xylenecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
