| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:45 UTC |
|---|
| Update Date | 2025-03-25 00:53:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198376 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11NO3 |
|---|
| Molecular Mass | 217.0739 |
|---|
| SMILES | CC1=C(C=O)C(=O)NC1c1cccc(O)c1 |
|---|
| InChI Key | GNRIJQAKGGTJFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolines |
|---|
| Subclass | phenylpyrrolines |
|---|
| Direct Parent | phenylpyrrolines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaldehydesazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolespyrroline carboxylic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundazacyclepyrroline carboxylic acid or derivativesaldehyde2-phenylpyrroline1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
