| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198384 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11O10P |
|---|
| Molecular Mass | 286.009 |
|---|
| SMILES | O=C(O)C1C(=O)OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | XGKHSYGBSNVJKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dicarbonyl compoundsbeta hydroxy acids and derivativescarboxylic acid esterscarboxylic acidsdelta valerolactonesdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic aciddelta valerolactonecarboxylic acid derivativelactonebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compound1,2-diolalcoholhydroxy acidoxacyclephosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhexose phosphatedicarboxylic acid or derivativeshydrocarbon derivative1,3-dicarbonyl compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
