| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198411 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H34N4O3S |
|---|
| Molecular Mass | 398.2352 |
|---|
| SMILES | CC(C)CC(N)C(=O)NCCC(=O)NCCSCc1ccc(CN(C)C)o1 |
|---|
| InChI Key | XBBPGISDTPHRKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsaralkylaminesbeta amino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfuransheteroaromatic compoundshydrocarbon derivativesleucine and derivativesmonoalkylaminesn-acyl aminesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidessulfenyl compoundstrialkylamines |
|---|
| Substituents | fatty acylfurancarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesfatty amidealpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativearalkylamineorganic oxideleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundsulfenyl compoundalpha-amino acid amidedialkylthioetherheteroaromatic compoundtertiary aliphatic aminecarboxamide groupn-acyl-aminebeta amino acid or derivativesoxacyclesecondary carboxylic acid amideorganic oxygen compoundthioetherhybrid peptidehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
