| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:47 UTC |
|---|
| Update Date | 2025-03-25 00:53:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198440 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O10 |
|---|
| Molecular Mass | 252.0117 |
|---|
| SMILES | O=C(O)C1OC(O)(C(=O)O)OC(C(=O)O)C1O |
|---|
| InChI Key | LPWSMLAYDOBPGE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidesorthocarboxylic acid derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidtricarboxylic acid or derivativeshydroxy acidoxacyclebeta-hydroxy acidorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorthocarboxylic acid derivativemeta-dioxaneorganoheterocyclic compoundorganooxygen compound |
|---|
