| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:49 UTC |
|---|
| Update Date | 2025-03-25 00:53:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198510 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8N2O4 |
|---|
| Molecular Mass | 220.0484 |
|---|
| SMILES | O=C(O)C(=O)Cc1c[nH]c2nc(O)ccc12 |
|---|
| InChI Key | HPOHIHBJZVIFCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolopyridines |
|---|
| Subclass | pyrrolopyridines |
|---|
| Direct Parent | pyrrolopyridines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalpha-hydroxy ketonesalpha-keto acids and derivativesazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidpolyhalopyridinealpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-keto acidorganopnictogen compound2-halopyridineazacyclepyrrolopyridineheteroaromatic compoundhydroxypyridinemonocarboxylic acid or derivativespyridineorganic oxygen compoundketo acidpyrrolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
