| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:50 UTC |
|---|
| Update Date | 2025-03-25 00:53:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198545 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7NO6S |
|---|
| Molecular Mass | 220.9994 |
|---|
| SMILES | NCc1cc(=O)c(OS(=O)(=O)O)co1 |
|---|
| InChI Key | GWPBPWBABBZZTH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | cyclic ketonesheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesteraromatic heteromonocyclic compoundheteroaromatic compoundcyclic ketoneoxacycleorganic oxideorganic oxygen compoundpyranorganonitrogen compoundpyranoneorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfateprimary aliphatic amineorganic nitrogen compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
