| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:52 UTC |
|---|
| Update Date | 2025-03-25 00:53:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198632 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19NO7 |
|---|
| Molecular Mass | 325.1162 |
|---|
| SMILES | O=C1CCC(Cc2c[nH]c(=O)c(C3OC(CO)C(O)C3O)c2)O1 |
|---|
| InChI Key | MIDPPEIDURQLLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | halopyridines |
|---|
| Direct Parent | polyhalopyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acid estersdialkyl ethersgamma butyrolactonesheteroaromatic compoundshydrocarbon derivativeshydroxypyridineslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyridinonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupetherlactamaromatic heteromonocyclic compoundpolyhalopyridinemonosaccharidecarboxylic acid derivativedialkyl etherlactonesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholazacycletetrahydrofuranheteroaromatic compoundhydroxypyridinegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundpyridinoneorganooxygen compound |
|---|
