| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:55 UTC |
|---|
| Update Date | 2025-03-25 00:53:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198772 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H26ClNO2 |
|---|
| Molecular Mass | 395.1652 |
|---|
| SMILES | CCOC(=O)N1CCC(=C2c3ccccc3CCCc3ccc(Cl)cc32)CC1 |
|---|
| InChI Key | PTNMTHXOTOBAIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsbenzenoidscarbamate esterscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspiperidines |
|---|
| Substituents | aryl chloridecarbonyl groupcarbonic acid derivativeazacycleorganochloridecarbamic acid esterorganohalogen compoundaryl halideorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
