| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:58:59 UTC |
|---|
| Update Date | 2025-03-25 00:53:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02198918 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O10P |
|---|
| Molecular Mass | 288.0246 |
|---|
| SMILES | O=C1OC(C(O)CO)C(O)(COP(=O)(O)O)C1O |
|---|
| InChI Key | BZHSZMSFCMKASX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcoholstertiary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativelactonesaccharideorganic oxidealiphatic heteromonocyclic compoundprimary alcoholorganoheterocyclic compoundalcoholtetrahydrofurangamma butyrolactoneoxacycletertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
