| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:05 UTC |
|---|
| Update Date | 2025-03-25 00:53:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199164 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18Cl4O7 |
|---|
| Molecular Mass | 413.9807 |
|---|
| SMILES | OC1C(Cl)C(O)C(OC2(CCl)OC(CCl)C(O)C2O)C(O)C1Cl |
|---|
| InChI Key | BOYQREOYBROELJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinscyclitols and derivativescyclohexyl halideshydrocarbon derivativesketalsmonosaccharidesorganochloridesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | chlorohydrintetrahydrofuranhalohydrinalkyl chlorideorganochloridecyclohexanolmonosaccharidecyclohexyl halidecyclitol or derivativescyclic alcoholorganohalogen compoundoxacyclesaccharideacetalketalaliphatic heteromonocyclic compoundalkyl halidehydrocarbon derivativeorganoheterocyclic compound |
|---|
