| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:06 UTC |
|---|
| Update Date | 2025-03-25 00:53:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199179 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18O4 |
|---|
| Molecular Mass | 202.1205 |
|---|
| SMILES | CCC1(O)CC(C)C(C)C(C(=O)O)O1 |
|---|
| InChI Key | UKPSVKKQDBQKFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acids |
|---|
| Substituents | c-glucuronidecarbonyl groupcarboxylic acidpyran carboxylic acid or derivativescarboxylic acid derivativepyran carboxylic acidoxacycleorganic oxidemonocarboxylic acid or derivativespyranaliphatic heteromonocyclic compoundhemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|
