| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:06 UTC |
|---|
| Update Date | 2025-03-25 00:53:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199207 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12NO6P |
|---|
| Molecular Mass | 237.0402 |
|---|
| SMILES | CC(=O)NC1COC2COP(=O)(O)OC12 |
|---|
| InChI Key | ZQNKTXINHIAWBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupethertetrahydrofurancarboxamide groupcarboxylic acid derivativedialkyl etheraliphatic heteropolycyclic compoundoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganoheterocyclic compoundacetamideorganooxygen compound |
|---|
