| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:07 UTC |
|---|
| Update Date | 2025-03-25 00:53:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199237 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13I2NO5 |
|---|
| Molecular Mass | 552.8883 |
|---|
| SMILES | NC(Cc1cc(I)c(Oc2ccc(O)c(C=O)c2)c(I)c1)C(=O)O |
|---|
| InChI Key | AUDCVADYFGNJFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamphetamines and derivativesaryl iodidesbenzoyl derivativescarboxylic acidsdiarylethersdiphenylethershydrocarbon derivativeshydroxybenzaldehydesiodobenzenesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylpropanoic acidsvinylogous acids |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acid3-phenylpropanoic-acidbenzoyl1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundiodobenzeneorganoiodideorganic oxidearyl-aldehydeorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesaldehydearyl halidearomatic homomonocyclic compoundvinylogous acidbenzaldehydemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compoundhydroxybenzaldehydediphenyletherorganooxygen compound |
|---|
