| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:11 UTC |
|---|
| Update Date | 2025-03-25 00:53:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199376 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11NO5 |
|---|
| Molecular Mass | 189.0637 |
|---|
| SMILES | NC(=O)C1CCCC(O)(C(=O)O)O1 |
|---|
| InChI Key | AHDIORUNQGSXLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesalpha-hydroxy acidhydroxy acidcarboxamide groupcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydrocarbon derivativeorganic nitrogen compoundoxaneorganooxygen compound |
|---|
