| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:12 UTC |
|---|
| Update Date | 2025-03-25 00:53:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199437 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO2 |
|---|
| Molecular Mass | 241.1103 |
|---|
| SMILES | Cc1cccc(C(=O)Nc2ccccc2O)c1C |
|---|
| InChI Key | UGIWODCWOYZKCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amideso-xylenes |
|---|
| Substituents | benzanilidebenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivative1-hydroxy-4-unsubstituted benzenoidcarboxamide groupbenzamidexylenearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideo-xyleneorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
