| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:16 UTC |
|---|
| Update Date | 2025-03-25 00:53:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199564 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO3S |
|---|
| Molecular Mass | 289.0773 |
|---|
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)Cc1ccccc1 |
|---|
| InChI Key | BHTMSHLZCSSBDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acids and derivativesphenylacetamidestoluenes |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupbenzenesulfonamideaminosulfonyl compoundorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundtoluenephenylacetamideorganooxygen compoundbenzenesulfonyl group |
|---|
