| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:17 UTC |
|---|
| Update Date | 2025-03-25 00:53:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199616 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H30N4O4S |
|---|
| Molecular Mass | 398.1988 |
|---|
| SMILES | NC(=O)C1=CC2C(CSC2CCCCC(=O)NCCCCC(N)C(=O)O)N1 |
|---|
| InChI Key | SFBAHPXCXDOTJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylaminesdialkylthioethersheterocyclic fatty acidshydrocarbon derivativesmedium-chain fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsprimary carboxylic acid amidespyrroline carboxylic acids and derivativessecondary carboxylic acid amidesthiolanes |
|---|
| Substituents | thiolaneprimary carboxylic acid amidefatty acylcarbonyl groupcarboxylic acidamino acidheterocyclic fatty acidfatty amidealiphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundmedium-chain fatty acidorganoheterocyclic compoundsecondary aliphatic amineazacycledialkylthioetherpyrroline carboxylic acid or derivativessecondary aminecarboxamide groupn-acyl-aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolinethioetherhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamine |
|---|