| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:18 UTC |
|---|
| Update Date | 2025-03-25 00:53:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199647 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N6O2S |
|---|
| Molecular Mass | 256.0742 |
|---|
| SMILES | N=C(N)NC(=N)NS(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | DGMSWVXNJRRNIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzenesulfonyl compoundsbiguanidescarboximidamideshydrocarbon derivativesiminesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesprimary amines |
|---|
| Substituents | organosulfonic acid or derivativesbenzenesulfonamideaminosulfonyl compoundguanidineiminecarboximidamideorganosulfur compoundaromatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundbiguanideaminebenzenesulfonyl group |
|---|
