| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:19 UTC |
|---|
| Update Date | 2025-03-25 00:53:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02199708 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N3O2 |
|---|
| Molecular Mass | 249.1477 |
|---|
| SMILES | N=C(C(N)Cc1ccc(O)cc1)N1CCC(O)C1 |
|---|
| InChI Key | ISAXWJKYROSZOZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamidinesazacyclic compoundsbenzene and substituted derivativescarboximidamideshydrocarbon derivativesmonoalkylaminesorganopnictogen compoundspyrrolidinessecondary alcohols |
|---|
| Substituents | alcoholaromatic heteromonocyclic compoundazacycle1-hydroxy-2-unsubstituted benzenoidamidinecarboximidamideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundphenolhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundpyrrolidineorganoheterocyclic compoundorganooxygen compoundamphetamine or derivatives |
|---|