| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:27 UTC |
|---|
| Update Date | 2025-03-25 00:53:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200020 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H4Cl4N2O2 |
|---|
| Molecular Mass | 311.9027 |
|---|
| SMILES | N#Cc1c(Cl)c(Cl)c(NC(=O)CO)c(Cl)c1Cl |
|---|
| InChI Key | JACOCLRVDJLIFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaryl chloridesbenzonitrilescarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-arylamidesnitrilesorganic oxidesorganochloridesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupnitrileorganochloriden-arylamidecarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundcarbonitrilearyl chloridechlorobenzenealcoholcarboxamide groupbenzonitrilearyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
