| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:29 UTC |
|---|
| Update Date | 2025-03-25 00:53:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200090 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15N3O6 |
|---|
| Molecular Mass | 309.0961 |
|---|
| SMILES | N=C(Nc1cccc(C(=O)O)c1)NC(CCC(=O)O)C(=O)O |
|---|
| InChI Key | CBBHIIKEOMVINP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsbenzoic acidsbenzoyl derivativescarbonyl compoundscarboximidamidescarboxylic acidsguanidinesguanidinobenzoic acids and derivativeshydrocarbon derivativesiminesorganic oxidesorganopnictogen compoundstricarboxylic acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidguanidineiminebenzoyltricarboxylic acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundbenzoic acidbenzoic acid or derivativesglutamic acid or derivativescarboximidamidearomatic homomonocyclic compoundorganic oxygen compoundhydrocarbon derivativebenzenoidguanidinobenzoic acid or derivativesorganic nitrogen compoundorganooxygen compound |
|---|
