| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:31 UTC |
|---|
| Update Date | 2025-03-25 00:53:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200143 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H27ClN8O2 |
|---|
| Molecular Mass | 446.1946 |
|---|
| SMILES | N=C(NCCCCCCNC(=N)NC(=O)c1ccco1)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | ZHTOVORZFLJLNU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | guanidines |
|---|
| Direct Parent | 1-arylbiguanides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarboximidamidescarboxylic acids and derivativeschlorobenzenesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesiminesorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | furanmonocyclic benzene moietyaromatic heteromonocyclic compoundimineorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxideorganopnictogen compound1-arylbiguanideorganoheterocyclic compoundaryl chloridechlorobenzenefuroic acid or derivativesheteroaromatic compoundcarboximidamidearyl halideoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|