| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:33 UTC |
|---|
| Update Date | 2025-03-25 00:53:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200240 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7NO5S |
|---|
| Molecular Mass | 205.0045 |
|---|
| SMILES | Cc1oc(S(N)(=O)=O)cc1C(=O)O |
|---|
| InChI Key | CELQRFDDSWCLGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundscarboxylic acidsfuran-3-carboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamidesoxacyclic compounds |
|---|
| Substituents | organosulfonic acid or derivativesfuran-3-carboxylic acidcarboxylic acidaromatic heteromonocyclic compoundaminosulfonyl compoundheteroaromatic compoundorganosulfur compoundcarboxylic acid derivativefuroic acidorganosulfonic acid amideoxacycleorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundfuran-3-carboxylic acid or derivativesorganooxygen compound |
|---|
