| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:36 UTC |
|---|
| Update Date | 2025-03-25 00:53:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200361 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO8 |
|---|
| Molecular Mass | 329.1111 |
|---|
| SMILES | Cc1ncc(COCC2OC(O)C(O)C(O)C2O)c(C=O)c1O |
|---|
| InChI Key | WSHSKNBKQJTZEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridine carboxaldehydes |
|---|
| Direct Parent | pyridoxals and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl-aldehydesazacyclic compoundsdialkyl ethershemiacetalsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespolyhalopyridinespyridinecarboxylic acids and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | pyridine carboxylic acid or derivativesetheraromatic heteromonocyclic compoundpolyhalopyridinemonosaccharidedialkyl ethersaccharideorganic oxidearyl-aldehydeorganonitrogen compoundorganopnictogen compoundhemiacetal2-halopyridineoxanealcoholpyridoxalazacycleheteroaromatic compoundhydroxypyridinealdehydeoxacyclevinylogous acidorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|