| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:37 UTC |
|---|
| Update Date | 2025-03-25 00:53:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200400 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H7N3O3S2 |
|---|
| Molecular Mass | 220.9929 |
|---|
| SMILES | Cc1ncc(SS(=O)(=O)O)c(N)n1 |
|---|
| InChI Key | POWZGNAITWBBHR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganopnictogen compoundsprimary aminessulfenyl compounds |
|---|
| Substituents | sulfenyl compoundaromatic heteromonocyclic compoundazacycleheteroaromatic compoundorganosulfur compoundpyrimidineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamine |
|---|