| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:38 UTC |
|---|
| Update Date | 2025-03-25 00:53:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200422 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO5 |
|---|
| Molecular Mass | 307.142 |
|---|
| SMILES | COc1ccc(CC(=O)N2CCC(C(=O)O)CC2)cc1OC |
|---|
| InChI Key | QKYABATXHGKBQW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundscarboxylic acidsdimethoxybenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspiperidinecarboxylic acidstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxideo-dimethoxybenzenetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidpiperidinephenylacetamideorganoheterocyclic compoundazacyclecarboxamide groupmethoxybenzenen-acyl-piperidinemonocarboxylic acid or derivativesorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|