| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:38 UTC |
|---|
| Update Date | 2025-03-25 00:53:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200432 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13NO3 |
|---|
| Molecular Mass | 207.0895 |
|---|
| SMILES | COc1ccc(C=CC(N)=O)c(OC)c1 |
|---|
| InChI Key | VUHXZTBUXALFLF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acids and derivativesdimethoxybenzeneshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidephenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl ethercarboxamide groupcarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compounddimethoxybenzenecinnamic acid or derivativesorganic oxideorganic oxygen compoundm-dimethoxybenzeneanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
