| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:39 UTC |
|---|
| Update Date | 2025-03-25 00:53:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200462 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O5 |
|---|
| Molecular Mass | 298.0841 |
|---|
| SMILES | COc1ccc(C=CC(=O)C(=O)c2ccc(O)cc2O)cc1 |
|---|
| InChI Key | PEYUKPXGBDZSAT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsalkyl aryl ethersalpha-diketonesanisolesaryl ketonesbenzoyl derivativesenoneshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundsresorcinolsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetherbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheralpha,beta-unsaturated ketoneresorcinolketonecinnamic acid or derivativesorganic oxideenone1-hydroxy-4-unsubstituted benzenoidmethoxybenzenealpha-diketonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compoundaryl ketone |
|---|
