| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:40 UTC |
|---|
| Update Date | 2025-03-25 00:53:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200507 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO2 |
|---|
| Molecular Mass | 269.1416 |
|---|
| SMILES | COc1ccc(CNC(=O)Cc2ccccc2C)cc1 |
|---|
| InChI Key | PDEWISWLNDXNQG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidestoluenes |
|---|
| Substituents | phenol ethercarbonyl groupetheralkyl aryl ethercarboxamide groupcarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundtoluenephenylacetamideorganooxygen compound |
|---|
