| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:40 UTC |
|---|
| Update Date | 2025-03-25 00:53:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200534 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17NO4 |
|---|
| Molecular Mass | 299.1158 |
|---|
| SMILES | COc1ccc(NC=O)c(C(=O)C(C)c2ccc(O)cc2)c1 |
|---|
| InChI Key | MXODSTFSXNBCHB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalkyl-phenylketonesanilidesanisolesaryl alkyl ketonesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundsphenylpropanessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidn-arylamidealkyl aryl ethercarboxylic acid derivativeketonephenylpropaneorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidecarboxamide groupmethoxybenzenephenylketonearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|
