| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:45 UTC |
|---|
| Update Date | 2025-03-25 00:53:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200709 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O5 |
|---|
| Molecular Mass | 290.1154 |
|---|
| SMILES | COc1ccc2cc(C(C(=O)O)C(O)C(C)O)ccc2c1 |
|---|
| InChI Key | RBIOTVWARZMDBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholphenol ethercarbonyl groupethercarboxylic acidaromatic homopolycyclic compoundhydroxy acidalkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganooxygen compound1,2-diol |
|---|