| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:45 UTC |
|---|
| Update Date | 2025-03-25 00:53:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200715 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H24ClNO3 |
|---|
| Molecular Mass | 301.1445 |
|---|
| SMILES | COCCc1ccc(OCC(O)CNC(C)C)cc1Cl |
|---|
| InChI Key | SRDBSRKDHKGWIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chlorideschlorobenzenesdialkyl ethersdialkylamineshydrocarbon derivativesorganochloridesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherorganochloridealkyl aryl etherorganohalogen compounddialkyl etherorganonitrogen compoundorganopnictogen compoundtyrosol derivativearyl chloridechlorobenzenealcoholsecondary aliphatic aminesecondary aminearyl halidearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compoundamine |
|---|