| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200745 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H28N2O4 |
|---|
| Molecular Mass | 456.2049 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC(=O)Cc4c[nH]c5ccccc45)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | KGIKWUVSWCFJEA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acid esterscoumaransheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinespyrrolestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethercarbonyl groupetheramino acid or derivativesindolealkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranphenanthreneazacycleheteroaromatic compoundtertiary aliphatic amineindole or derivativesoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
