| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:59:46 UTC |
|---|
| Update Date | 2025-03-25 00:53:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02200764 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O5S |
|---|
| Molecular Mass | 232.0405 |
|---|
| SMILES | COc1cccc(OC)c1S(=O)(=O)OC |
|---|
| InChI Key | RRTYZQCVYARQCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonic acids and derivatives |
|---|
| Direct Parent | benzenesulfonate esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesarylsulfonic acids and derivativesbenzenesulfonyl compoundsdimethoxybenzeneshydrocarbon derivativesorganic oxidesorganosulfonic acid estersphenoxy compoundssulfonyls |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativesbenzenesulfonate esteretheralkyl aryl etherorganosulfur compounddimethoxybenzeneorganic oxidebenzenesulfonyl groupmethoxybenzeneorganosulfonic acid esteraromatic homomonocyclic compoundsulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativesm-dimethoxybenzeneanisolehydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|